The Production Process of 2-Pyridinecarbonitrile,5-formyl-(9CI)

2-Pyridinecarbonitrile,5-formyl-(9CI) is a chemical compound that is commonly used in various industrial applications.
The production process of this compound involves a series of chemical reactions that convert raw materials into the desired product.
In this article, we will discuss the production process of 2-Pyridinecarbonitrile,5-formyl-(9CI) in the chemical industry.

Step 1: Preparation of Raw Materials
The production of 2-Pyridinecarbonitrile,5-formyl-(9CI) begins with the preparation of raw materials.
The primary raw material for the production of this compound is anthranilic acid, which is derived from the reaction of nitrobenzene and o-aminobenzene.
Other raw materials used in the production process include sodium cyanide, hydrochloric acid, and water.

Step 2: Formation of Nitrosonium Ion
The next step in the production process is the formation of the nitrosonium ion.
This is achieved by the reaction of nitrobenzene and sulfuric acid, which results in the formation of nitrosonium sulfate.
This reaction is exothermic, and the heat generated is used to drive the subsequent reactions.

Step 3: Reduction of Nitrosonium Ion
The nitrosonium ion is then reduced to form the oxalate ion.
This is achieved by the reaction of the nitrosonium ion with sodium hydroxide, which results in the formation of sodium nitrone.
The reaction is as follows:

NO3 + NaOH → NO-Na+ + H2O

Step 4: Cyanation of Anthranilic Acid
The oxalate ion is used in the cyanation of anthranilic acid, which involves the formation of a urea-like compound.
This reaction is achieved by the reaction of the oxalate ion with anthranilic acid in the presence of an acid catalyst.
The reaction is as follows:

NO-Na+ + C6H4(NO2)COOH → C6H4N2O-Na+ + NaNO3

Step 5: Hydrolysis of the Urea-like Compound
The urea-like compound formed in the previous step is then hydrolyzed to form the 2-pyridinecarbonitrile,5-formyl-(9CI).
The hydrolysis reaction is achieved by the reaction of the urea-like compound with water in the presence of an acid catalyst.
The reaction is as follows:

C6H4N2O-Na+ + H2O → C6H5N-C(=N)-C6H4-N2-C(=O)H

Step 6: Dehydration of the Hydrolysis Product
The final step in the production process is the dehydration of the hydrolysis product to form the desired 2-Pyridinecarbonitrile,5-formyl-(9CI).
This is achieved by the reaction of the hydrolysis product with hydrogen chloride in the presence of an acid catalyst.
The reaction is as follows:

C6H5N-C(=N)-C6H4-N2-C(=O)H + HCl → C6H4N2-C(=N)-C6H5 + H2O

Overall Production Process
The overall production process of 2-Pyridinecarbonitrile,5-formyl-(9CI) involves several chemical reactions, including the formation of the nitrosonium ion, reduction of the nitrosonium ion, cyanation of anthranilic acid, hydrolysis of the urea-like compound, and dehydration of the hydrolysis product.
Each of these reactions is carefully controlled to ensure the production of the desired product in high yields and with a high degree of pur